C11H11F2N2O4P — CID 169170618
[difluoro-[2-(methylcarbamoyl)-1H-indol-5-yl]methyl]phosphonic acid (PubChem CID 169170618) has the molecular formula C11H11F2N2O4P and a molecular weight of 304.19 g/mol. Its IUPAC name is [difluoro-[2-(methylcarbamoyl)-1H-indol-5-yl]methyl]phosphonic acid.
| Compound Name | [difluoro-[2-(methylcarbamoyl)-1H-indol-5-yl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 169170618 |
| Molecular Formula | C11H11F2N2O4P |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | [difluoro-[2-(methylcarbamoyl)-1H-indol-5-yl]methyl]phosphonic acid |
| SMILES | CNC(=O)c1cc2cc(C(F)(F)P(=O)(O)O)ccc2[nH]1 |
| InChI | InChI=1S/C11H11F2N2O4P/c1-14-10(16)9-5-6-4-7(2-3-8(6)15-9)11(12,13)20(17,18)19/h2-5,15H,1H3,(H,14,16)(H2,17,18,19) |
| InChIKey | XSUNCHLJJQIWDM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|