C12H9F4O6P2- — CID 91930935
[[7-[difluoro(phosphono)methyl]naphthalen-2-yl]-difluoromethyl]-hydroxyphosphinate (PubChem CID 91930935) has the molecular formula C12H9F4O6P2- and a molecular weight of 387.14 g/mol. Its IUPAC name is [[7-[difluoro(phosphono)methyl]naphthalen-2-yl]-difluoromethyl]-hydroxyphosphinate.
| Compound Name | [[7-[difluoro(phosphono)methyl]naphthalen-2-yl]-difluoromethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 91930935 |
| Molecular Formula | C12H9F4O6P2- |
| Molecular Weight | 387.14 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | [[7-[difluoro(phosphono)methyl]naphthalen-2-yl]-difluoromethyl]-hydroxyphosphinate |
| SMILES | O=P([O-])(O)C(F)(F)c1ccc2ccc(C(F)(F)P(=O)(O)O)cc2c1 |
| InChI | InChI=1S/C12H10F4O6P2/c13-11(14,23(17,18)19)9-3-1-7-2-4-10(6-8(7)5-9)12(15,16)24(20,21)22/h1-6H,(H2,17,18,19)(H2,20,21,22)/p-1 |
| InChIKey | VHKBLEYUHBIBNR-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|