C16H16F2NO4P — CID 46878793
[difluoro-[4-(2-phenylethylcarbamoyl)phenyl]methyl]phosphonic acid (PubChem CID 46878793) has the molecular formula C16H16F2NO4P and a molecular weight of 355.28 g/mol. Its IUPAC name is [difluoro-[4-(2-phenylethylcarbamoyl)phenyl]methyl]phosphonic acid.
| Compound Name | [difluoro-[4-(2-phenylethylcarbamoyl)phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 46878793 |
| Molecular Formula | C16H16F2NO4P |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [difluoro-[4-(2-phenylethylcarbamoyl)phenyl]methyl]phosphonic acid |
| SMILES | O=C(NCCc1ccccc1)c1ccc(C(F)(F)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C16H16F2NO4P/c17-16(18,24(21,22)23)14-8-6-13(7-9-14)15(20)19-11-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,20)(H2,21,22,23) |
| InChIKey | PLSMNDIPRTXABY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|