C19H20F3NO2 — CID 91126455
N-(3-phenylpropyl)-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide (PubChem CID 91126455) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-(3-phenylpropyl)-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide.
| Compound Name | N-(3-phenylpropyl)-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 91126455 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(3-phenylpropyl)-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide |
| SMILES | CC(O)(c1ccc(C(=O)NCCCc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO2/c1-18(25,19(20,21)22)16-11-9-15(10-12-16)17(24)23-13-5-8-14-6-3-2-4-7-14/h2-4,6-7,9-12,25H,5,8,13H2,1H3,(H,23,24) |
| InChIKey | YTYCMEQIERUPIZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|