C18H24F5NO — CID 173258469
4-hexyl-N-(4,4,5,5,5-pentafluoropentyl)benzamide (PubChem CID 173258469) has the molecular formula C18H24F5NO and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-hexyl-N-(4,4,5,5,5-pentafluoropentyl)benzamide.
| Compound Name | 4-hexyl-N-(4,4,5,5,5-pentafluoropentyl)benzamide |
|---|---|
| PubChem CID | 173258469 |
| Molecular Formula | C18H24F5NO |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 4-hexyl-N-(4,4,5,5,5-pentafluoropentyl)benzamide |
| SMILES | CCCCCCc1ccc(C(=O)NCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F5NO/c1-2-3-4-5-7-14-8-10-15(11-9-14)16(25)24-13-6-12-17(19,20)18(21,22)23/h8-11H,2-7,12-13H2,1H3,(H,24,25) |
| InChIKey | RBAUOVZSSRAKAO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|