C16H14F3NOS — CID 24654315
N-(2-phenylethyl)-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 24654315) has the molecular formula C16H14F3NOS and a molecular weight of 325.36 g/mol. Its IUPAC name is N-(2-phenylethyl)-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(2-phenylethyl)-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 24654315 |
| Molecular Formula | C16H14F3NOS |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(2-phenylethyl)-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NOS/c17-16(18,19)22-14-8-6-13(7-9-14)15(21)20-11-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,21) |
| InChIKey | BRVSCGVYQRDPLN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |