C12H10F3NOS — CID 158445206
N-(cyclopropen-1-ylmethyl)-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 158445206) has the molecular formula C12H10F3NOS and a molecular weight of 273.28 g/mol. Its IUPAC name is N-(cyclopropen-1-ylmethyl)-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(cyclopropen-1-ylmethyl)-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 158445206 |
| Molecular Formula | C12H10F3NOS |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-(cyclopropen-1-ylmethyl)-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(NCC1=CC1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3NOS/c13-12(14,15)18-10-5-3-9(4-6-10)11(17)16-7-8-1-2-8/h1,3-6H,2,7H2,(H,16,17) |
| InChIKey | CUFBWKOVEPHUPL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|