C18H19F3N2OS — CID 9069473
N-[[2-[(dimethylamino)methyl]phenyl]methyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 9069473) has the molecular formula C18H19F3N2OS and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[[2-[(dimethylamino)methyl]phenyl]methyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[[2-[(dimethylamino)methyl]phenyl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 9069473 |
| Molecular Formula | C18H19F3N2OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[[2-[(dimethylamino)methyl]phenyl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | CN(C)Cc1ccccc1CNC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2OS/c1-23(2)12-15-6-4-3-5-14(15)11-22-17(24)13-7-9-16(10-8-13)25-18(19,20)21/h3-10H,11-12H2,1-2H3,(H,22,24) |
| InChIKey | YYMOBKKDTAZRDS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |