C19H21F3N4OS — CID 55742686
N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 55742686) has the molecular formula C19H21F3N4OS and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55742686 |
| Molecular Formula | C19H21F3N4OS |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | CN1CCN(c2cc(CNC(=O)c3ccc(SC(F)(F)F)cc3)ccn2)CC1 |
| InChI | InChI=1S/C19H21F3N4OS/c1-25-8-10-26(11-9-25)17-12-14(6-7-23-17)13-24-18(27)15-2-4-16(5-3-15)28-19(20,21)22/h2-7,12H,8-11,13H2,1H3,(H,24,27) |
| InChIKey | LEJBKADCEOJIEW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |