C18H19Cl2FN4O — CID 55742565
2,4-dichloro-5-fluoro-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]benzamide (PubChem CID 55742565) has the molecular formula C18H19Cl2FN4O and a molecular weight of 397.28 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55742565 |
| Molecular Formula | C18H19Cl2FN4O |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]benzamide |
| SMILES | CN1CCN(c2cc(CNC(=O)c3cc(F)c(Cl)cc3Cl)ccn2)CC1 |
| InChI | InChI=1S/C18H19Cl2FN4O/c1-24-4-6-25(7-5-24)17-8-12(2-3-22-17)11-23-18(26)13-9-16(21)15(20)10-14(13)19/h2-3,8-10H,4-7,11H2,1H3,(H,23,26) |
| InChIKey | NWDCYSXZNNKWOU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|