C39H35NO4 — CID 91489702
1-[4-(4-acetylphenyl)phenyl]ethanone;4-(4-acetylphenyl)-N-(2-phenylethyl)benzamide (PubChem CID 91489702) has the molecular formula C39H35NO4 and a molecular weight of 581.71 g/mol. Its IUPAC name is 1-[4-(4-acetylphenyl)phenyl]ethanone;4-(4-acetylphenyl)-N-(2-phenylethyl)benzamide.
| Compound Name | 1-[4-(4-acetylphenyl)phenyl]ethanone;4-(4-acetylphenyl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 91489702 |
| Molecular Formula | C39H35NO4 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 1-[4-(4-acetylphenyl)phenyl]ethanone;4-(4-acetylphenyl)-N-(2-phenylethyl)benzamide |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)NCCc3ccccc3)cc2)cc1.CC(=O)c1ccc(-c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H21NO2.C16H14O2/c1-17(25)19-7-9-20(10-8-19)21-11-13-22(14-12-21)23(26)24-16-15-18-5-3-2-4-6-18;1-11(17)13-3-7-15(8-4-13)16-9-5-14(6-10-16)12(2)18/h2-14H,15-16H2,1H3,(H,24,26);3-10H,1-2H3 |
| InChIKey | XEVJRPRRSAKPRG-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |