C32H33NO2 — CID 139904878
N-[2-(4-tert-butylphenyl)ethyl]-4-(4-phenylmethoxyphenyl)benzamide (PubChem CID 139904878) has the molecular formula C32H33NO2 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)ethyl]-4-(4-phenylmethoxyphenyl)benzamide.
| Compound Name | N-[2-(4-tert-butylphenyl)ethyl]-4-(4-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 139904878 |
| Molecular Formula | C32H33NO2 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)ethyl]-4-(4-phenylmethoxyphenyl)benzamide |
| SMILES | CC(C)(C)c1ccc(CCNC(=O)c2ccc(-c3ccc(OCc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H33NO2/c1-32(2,3)29-17-9-24(10-18-29)21-22-33-31(34)28-13-11-26(12-14-28)27-15-19-30(20-16-27)35-23-25-7-5-4-6-8-25/h4-20H,21-23H2,1-3H3,(H,33,34) |
| InChIKey | WRZYTWIMNFQLEM-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |