C21H25F3N4O — CID 111295499
N-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]benzamide (PubChem CID 111295499) has the molecular formula C21H25F3N4O and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111295499 |
| Molecular Formula | C21H25F3N4O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[3-[[N'-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(\NCCCNC(=O)c1ccccc1)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3N4O/c1-25-20(27-14-5-13-26-19(29)17-6-3-2-4-7-17)28-15-12-16-8-10-18(11-9-16)21(22,23)24/h2-4,6-11H,5,12-15H2,1H3,(H,26,29)(H2,25,27,28) |
| InChIKey | CZDSQHAPRNPBQI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|