C11H11F2O7P — CID 150506499
3-[[4-[difluoro(phosphono)methyl]phenyl]methoxy]-3-oxopropanoic acid (PubChem CID 150506499) has the molecular formula C11H11F2O7P and a molecular weight of 324.17 g/mol. Its IUPAC name is 3-[[4-[difluoro(phosphono)methyl]phenyl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[4-[difluoro(phosphono)methyl]phenyl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 150506499 |
| Molecular Formula | C11H11F2O7P |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-[[4-[difluoro(phosphono)methyl]phenyl]methoxy]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)OCc1ccc(C(F)(F)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C11H11F2O7P/c12-11(13,21(17,18)19)8-3-1-7(2-4-8)6-20-10(16)5-9(14)15/h1-4H,5-6H2,(H,14,15)(H2,17,18,19) |
| InChIKey | HYXWMZDKZUWARU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|