C21H25F2N2O7P — CID 11533189
[difluoro-[4-[(2S)-3-(3-hydroxypropylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl]methyl]phosphonic acid (PubChem CID 11533189) has the molecular formula C21H25F2N2O7P and a molecular weight of 486.41 g/mol. Its IUPAC name is [difluoro-[4-[(2S)-3-(3-hydroxypropylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl]methyl]phosphonic acid.
| Compound Name | [difluoro-[4-[(2S)-3-(3-hydroxypropylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 11533189 |
| Molecular Formula | C21H25F2N2O7P |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [difluoro-[4-[(2S)-3-(3-hydroxypropylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl]methyl]phosphonic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)NCCCO)OCc1ccccc1 |
| InChI | InChI=1S/C21H25F2N2O7P/c22-21(23,33(29,30)31)17-9-7-15(8-10-17)13-18(19(27)24-11-4-12-26)25-20(28)32-14-16-5-2-1-3-6-16/h1-3,5-10,18,26H,4,11-14H2,(H,24,27)(H,25,28)(H2,29,30,31)/t18-/m0/s1 |
| InChIKey | RBUHYYBPDAJBJZ-SFHVURJKSA-N |
| XLogP | 2.25 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|