C23H30F2N3O6P — CID 87565567
difluoromethyl-[4-[(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenoxy]phosphinic acid (PubChem CID 87565567) has the molecular formula C23H30F2N3O6P and a molecular weight of 513.48 g/mol. Its IUPAC name is difluoromethyl-[4-[(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenoxy]phosphinic acid.
| Compound Name | difluoromethyl-[4-[(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 87565567 |
| Molecular Formula | C23H30F2N3O6P |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | difluoromethyl-[4-[(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenoxy]phosphinic acid |
| SMILES | CN(C)CCCNC(=O)[C@H](Cc1ccc(OP(=O)(O)C(F)F)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H30F2N3O6P/c1-28(2)14-6-13-26-21(29)20(27-23(30)33-16-18-7-4-3-5-8-18)15-17-9-11-19(12-10-17)34-35(31,32)22(24)25/h3-5,7-12,20,22H,6,13-16H2,1-2H3,(H,26,29)(H,27,30)(H,31,32)/t20-/m0/s1 |
| InChIKey | JXFDHZPZTNNZMK-FQEVSTJZSA-N |
| XLogP | 3.38 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|