C21H24F5N2O6PS — CID 87568827
difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(trifluoromethylsulfonylamino)propyl]phenoxy]phosphinic acid (PubChem CID 87568827) has the molecular formula C21H24F5N2O6PS and a molecular weight of 558.46 g/mol. Its IUPAC name is difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(trifluoromethylsulfonylamino)propyl]phenoxy]phosphinic acid.
| Compound Name | difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(trifluoromethylsulfonylamino)propyl]phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 87568827 |
| Molecular Formula | C21H24F5N2O6PS |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(trifluoromethylsulfonylamino)propyl]phenoxy]phosphinic acid |
| SMILES | O=C(NCCCCc1ccccc1)[C@H](Cc1ccc(OP(=O)(O)C(F)F)cc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H24F5N2O6PS/c22-20(23)35(30,31)34-17-11-9-16(10-12-17)14-18(28-36(32,33)21(24,25)26)19(29)27-13-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-12,18,20,28H,4-5,8,13-14H2,(H,27,29)(H,30,31)/t18-/m0/s1 |
| InChIKey | CQZXTUYWWWDSDU-SFHVURJKSA-N |
| XLogP | 3.96 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|