C36H44F2N3O6PS — CID 87567662
3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-N-(4-phenylbutyl)propanamide (PubChem CID 87567662) has the molecular formula C36H44F2N3O6PS and a molecular weight of 715.80 g/mol. Its IUPAC name is 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-N-(4-phenylbutyl)propanamide.
| Compound Name | 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-N-(4-phenylbutyl)propanamide |
|---|---|
| PubChem CID | 87567662 |
| Molecular Formula | C36H44F2N3O6PS |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 3-[4-[diethoxyphosphoryl(difluoro)methyl]phenyl]-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-N-(4-phenylbutyl)propanamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)c1ccc(CC(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)C(=O)NCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H44F2N3O6PS/c1-5-46-48(43,47-6-2)36(37,38)29-23-21-28(22-24-29)26-32(35(42)39-25-11-10-16-27-14-8-7-9-15-27)40-49(44,45)34-20-13-17-30-31(34)18-12-19-33(30)41(3)4/h7-9,12-15,17-24,32,40H,5-6,10-11,16,25-26H2,1-4H3,(H,39,42) |
| InChIKey | YUUGGKGLRZXBSB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|