C22H30F2N3O6PS — CID 11577379
[[4-[(2S)-2-(2-aminoethylsulfonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11577379) has the molecular formula C22H30F2N3O6PS and a molecular weight of 533.53 g/mol. Its IUPAC name is [[4-[(2S)-2-(2-aminoethylsulfonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[(2S)-2-(2-aminoethylsulfonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11577379 |
| Molecular Formula | C22H30F2N3O6PS |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | [[4-[(2S)-2-(2-aminoethylsulfonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | NCCS(=O)(=O)N[C@@H](Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C22H30F2N3O6PS/c23-22(24,34(29,30)31)19-11-9-18(10-12-19)16-20(27-35(32,33)15-13-25)21(28)26-14-5-4-8-17-6-2-1-3-7-17/h1-3,6-7,9-12,20,27H,4-5,8,13-16,25H2,(H,26,28)(H2,29,30,31)/t20-/m0/s1 |
| InChIKey | HRCNYGBCKMXBJA-FQEVSTJZSA-N |
| XLogP | 1.84 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|