C25H26ClF2N2O7PS — CID 11635751
[[4-[(2S)-2-(benzenesulfonamido)-3-[3-(3-chlorophenoxy)propylamino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11635751) has the molecular formula C25H26ClF2N2O7PS and a molecular weight of 602.98 g/mol. Its IUPAC name is [[4-[(2S)-2-(benzenesulfonamido)-3-[3-(3-chlorophenoxy)propylamino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[(2S)-2-(benzenesulfonamido)-3-[3-(3-chlorophenoxy)propylamino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11635751 |
| Molecular Formula | C25H26ClF2N2O7PS |
| Molecular Weight | 602.98 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | [[4-[(2S)-2-(benzenesulfonamido)-3-[3-(3-chlorophenoxy)propylamino]-3-oxopropyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(NCCCOc1cccc(Cl)c1)[C@H](Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26ClF2N2O7PS/c26-20-6-4-7-21(17-20)37-15-5-14-29-24(31)23(30-39(35,36)22-8-2-1-3-9-22)16-18-10-12-19(13-11-18)25(27,28)38(32,33)34/h1-4,6-13,17,23,30H,5,14-16H2,(H,29,31)(H2,32,33,34)/t23-/m0/s1 |
| InChIKey | KRFKKHROOFTGLW-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|