C27H31F2N2O6PS — CID 68764448
[difluoro-[4-[2-[(4-methylphenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]methyl]phosphonic acid (PubChem CID 68764448) has the molecular formula C27H31F2N2O6PS and a molecular weight of 580.59 g/mol. Its IUPAC name is [difluoro-[4-[2-[(4-methylphenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]methyl]phosphonic acid.
| Compound Name | [difluoro-[4-[2-[(4-methylphenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 68764448 |
| Molecular Formula | C27H31F2N2O6PS |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [difluoro-[4-[2-[(4-methylphenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]methyl]phosphonic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccc(C(F)(F)P(=O)(O)O)cc2)C(=O)NCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H31F2N2O6PS/c1-20-10-16-24(17-11-20)39(36,37)31-25(26(32)30-18-6-5-9-21-7-3-2-4-8-21)19-22-12-14-23(15-13-22)27(28,29)38(33,34)35/h2-4,7-8,10-17,25,31H,5-6,9,18-19H2,1H3,(H,30,32)(H2,33,34,35) |
| InChIKey | IZKLYYQUFLVISA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|