C36H44F2N3O6PS — CID 87567663
butan-2-yloxy-[[4-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphinic acid (PubChem CID 87567663) has the molecular formula C36H44F2N3O6PS and a molecular weight of 715.80 g/mol. Its IUPAC name is butan-2-yloxy-[[4-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[[4-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphinic acid |
|---|---|
| PubChem CID | 87567663 |
| Molecular Formula | C36H44F2N3O6PS |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | butan-2-yloxy-[[4-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenyl]-difluoromethyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(F)(F)c1ccc(CC(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)C(=O)NCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H44F2N3O6PS/c1-5-26(2)47-48(43,44)36(37,38)29-22-20-28(21-23-29)25-32(35(42)39-24-10-9-15-27-13-7-6-8-14-27)40-49(45,46)34-19-12-16-30-31(34)17-11-18-33(30)41(3)4/h6-8,11-14,16-23,26,32,40H,5,9-10,15,24-25H2,1-4H3,(H,39,42)(H,43,44) |
| InChIKey | ASKFHMDTKWVKPI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|