C26H27Cl2F2N2O6PS — CID 87568398
[4-[(2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]-(difluoromethyl)phosphinic acid (PubChem CID 87568398) has the molecular formula C26H27Cl2F2N2O6PS and a molecular weight of 635.45 g/mol. Its IUPAC name is [4-[(2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]-(difluoromethyl)phosphinic acid.
| Compound Name | [4-[(2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]-(difluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 87568398 |
| Molecular Formula | C26H27Cl2F2N2O6PS |
| Molecular Weight | 635.45 g/mol |
| Exact Mass | 634.07 |
| IUPAC Name | [4-[(2S)-2-[(3,4-dichlorophenyl)sulfonylamino]-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]-(difluoromethyl)phosphinic acid |
| SMILES | O=C(NCCCCc1ccccc1)[C@H](Cc1ccc(OP(=O)(O)C(F)F)cc1)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H27Cl2F2N2O6PS/c27-22-14-13-21(17-23(22)28)40(36,37)32-24(25(33)31-15-5-4-8-18-6-2-1-3-7-18)16-19-9-11-20(12-10-19)38-39(34,35)26(29)30/h1-3,6-7,9-14,17,24,26,32H,4-5,8,15-16H2,(H,31,33)(H,34,35)/t24-/m0/s1 |
| InChIKey | MQLPJCICIMFOEU-DEOSSOPVSA-N |
| XLogP | 5.81 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|