C26H26F5N2O8PS — CID 87567045
[4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[3-[4-(trifluoromethoxy)phenoxy]propylamino]propyl]phenoxy]-(difluoromethyl)phosphinic acid (PubChem CID 87567045) has the molecular formula C26H26F5N2O8PS and a molecular weight of 652.53 g/mol. Its IUPAC name is [4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[3-[4-(trifluoromethoxy)phenoxy]propylamino]propyl]phenoxy]-(difluoromethyl)phosphinic acid.
| Compound Name | [4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[3-[4-(trifluoromethoxy)phenoxy]propylamino]propyl]phenoxy]-(difluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 87567045 |
| Molecular Formula | C26H26F5N2O8PS |
| Molecular Weight | 652.53 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | [4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[3-[4-(trifluoromethoxy)phenoxy]propylamino]propyl]phenoxy]-(difluoromethyl)phosphinic acid |
| SMILES | O=C(NCCCOc1ccc(OC(F)(F)F)cc1)[C@H](Cc1ccc(OP(=O)(O)C(F)F)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26F5N2O8PS/c27-25(28)42(35,36)41-21-9-7-18(8-10-21)17-23(33-43(37,38)22-5-2-1-3-6-22)24(34)32-15-4-16-39-19-11-13-20(14-12-19)40-26(29,30)31/h1-3,5-14,23,25,33H,4,15-17H2,(H,32,34)(H,35,36)/t23-/m0/s1 |
| InChIKey | NQGILDPZDRLINE-QHCPKHFHSA-N |
| XLogP | 4.85 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|