C25H26F2N2O4S — CID 55935368
(2S)-N-[4-(4-fluorophenoxy)butyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 55935368) has the molecular formula C25H26F2N2O4S and a molecular weight of 488.56 g/mol. Its IUPAC name is (2S)-N-[4-(4-fluorophenoxy)butyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[4-(4-fluorophenoxy)butyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55935368 |
| Molecular Formula | C25H26F2N2O4S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (2S)-N-[4-(4-fluorophenoxy)butyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C25H26F2N2O4S/c26-20-12-14-21(15-13-20)33-17-7-6-16-28-25(30)23(18-19-8-2-1-3-9-19)29-34(31,32)24-11-5-4-10-22(24)27/h1-5,8-15,23,29H,6-7,16-18H2,(H,28,30)/t23-/m0/s1 |
| InChIKey | RUGCCZLDMDFLGU-QHCPKHFHSA-N |
| XLogP | 3.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|