C25H28F2N3O6PS — CID 87567653
difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(pyridin-2-ylsulfonylamino)propyl]phenoxy]phosphinic acid (PubChem CID 87567653) has the molecular formula C25H28F2N3O6PS and a molecular weight of 567.55 g/mol. Its IUPAC name is difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(pyridin-2-ylsulfonylamino)propyl]phenoxy]phosphinic acid.
| Compound Name | difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(pyridin-2-ylsulfonylamino)propyl]phenoxy]phosphinic acid |
|---|---|
| PubChem CID | 87567653 |
| Molecular Formula | C25H28F2N3O6PS |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | difluoromethyl-[4-[(2S)-3-oxo-3-(4-phenylbutylamino)-2-(pyridin-2-ylsulfonylamino)propyl]phenoxy]phosphinic acid |
| SMILES | O=C(NCCCCc1ccccc1)[C@H](Cc1ccc(OP(=O)(O)C(F)F)cc1)NS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C25H28F2N3O6PS/c26-25(27)37(32,33)36-21-14-12-20(13-15-21)18-22(30-38(34,35)23-11-5-7-16-28-23)24(31)29-17-6-4-10-19-8-2-1-3-9-19/h1-3,5,7-9,11-16,22,25,30H,4,6,10,17-18H2,(H,29,31)(H,32,33)/t22-/m0/s1 |
| InChIKey | STWSYZYNCZESOJ-QFIPXVFZSA-N |
| XLogP | 3.90 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|