C27H31N3O6S — CID 21132852
2-[2-amino-4-[2-(benzenesulfonamido)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid (PubChem CID 21132852) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[2-amino-4-[2-(benzenesulfonamido)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid.
| Compound Name | 2-[2-amino-4-[2-(benzenesulfonamido)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21132852 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-[2-amino-4-[2-(benzenesulfonamido)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid |
| SMILES | Nc1cc(CC(NS(=O)(=O)c2ccccc2)C(=O)NCCCCc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H31N3O6S/c28-23-17-21(14-15-25(23)36-19-26(31)32)18-24(30-37(34,35)22-12-5-2-6-13-22)27(33)29-16-8-7-11-20-9-3-1-4-10-20/h1-6,9-10,12-15,17,24,30H,7-8,11,16,18-19,28H2,(H,29,33)(H,31,32) |
| InChIKey | QVPZBXABKOSQTC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|