C28H29N3O7 — CID 18477032
2-(carboxymethoxy)-5-[3-oxo-3-(4-phenylbutylamino)-2-(pyridine-3-carbonylamino)propyl]benzoic acid (PubChem CID 18477032) has the molecular formula C28H29N3O7 and a molecular weight of 519.55 g/mol. Its IUPAC name is 2-(carboxymethoxy)-5-[3-oxo-3-(4-phenylbutylamino)-2-(pyridine-3-carbonylamino)propyl]benzoic acid.
| Compound Name | 2-(carboxymethoxy)-5-[3-oxo-3-(4-phenylbutylamino)-2-(pyridine-3-carbonylamino)propyl]benzoic acid |
|---|---|
| PubChem CID | 18477032 |
| Molecular Formula | C28H29N3O7 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-(carboxymethoxy)-5-[3-oxo-3-(4-phenylbutylamino)-2-(pyridine-3-carbonylamino)propyl]benzoic acid |
| SMILES | O=C(O)COc1ccc(CC(NC(=O)c2cccnc2)C(=O)NCCCCc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C28H29N3O7/c32-25(33)18-38-24-12-11-20(15-22(24)28(36)37)16-23(31-26(34)21-10-6-13-29-17-21)27(35)30-14-5-4-9-19-7-2-1-3-8-19/h1-3,6-8,10-13,15,17,23H,4-5,9,14,16,18H2,(H,30,35)(H,31,34)(H,32,33)(H,36,37) |
| InChIKey | DOYHSQCLFVYELQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|