C27H27ClN2O8 — CID 56986176
2-(carboxymethoxy)-5-[(2S)-3-[4-(4-chlorophenyl)butylamino]-2-(furan-3-carbonylamino)-3-oxopropyl]benzoic acid (PubChem CID 56986176) has the molecular formula C27H27ClN2O8 and a molecular weight of 542.97 g/mol. Its IUPAC name is 2-(carboxymethoxy)-5-[(2S)-3-[4-(4-chlorophenyl)butylamino]-2-(furan-3-carbonylamino)-3-oxopropyl]benzoic acid.
| Compound Name | 2-(carboxymethoxy)-5-[(2S)-3-[4-(4-chlorophenyl)butylamino]-2-(furan-3-carbonylamino)-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 56986176 |
| Molecular Formula | C27H27ClN2O8 |
| Molecular Weight | 542.97 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-(carboxymethoxy)-5-[(2S)-3-[4-(4-chlorophenyl)butylamino]-2-(furan-3-carbonylamino)-3-oxopropyl]benzoic acid |
| SMILES | O=C(O)COc1ccc(C[C@H](NC(=O)c2ccoc2)C(=O)NCCCCc2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C27H27ClN2O8/c28-20-7-4-17(5-8-20)3-1-2-11-29-26(34)22(30-25(33)19-10-12-37-15-19)14-18-6-9-23(38-16-24(31)32)21(13-18)27(35)36/h4-10,12-13,15,22H,1-3,11,14,16H2,(H,29,34)(H,30,33)(H,31,32)(H,35,36)/t22-/m0/s1 |
| InChIKey | SXDFYKTVDDDPQU-QFIPXVFZSA-N |
| XLogP | 3.57 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.97 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|