C27H27N3O6 — CID 59897148
2-[2-cyano-4-[(2S)-2-(furan-3-carbonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid (PubChem CID 59897148) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-[2-cyano-4-[(2S)-2-(furan-3-carbonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid.
| Compound Name | 2-[2-cyano-4-[(2S)-2-(furan-3-carbonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 59897148 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 2-[2-cyano-4-[(2S)-2-(furan-3-carbonylamino)-3-oxo-3-(4-phenylbutylamino)propyl]phenoxy]acetic acid |
| SMILES | N#Cc1cc(C[C@H](NC(=O)c2ccoc2)C(=O)NCCCCc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H27N3O6/c28-16-22-14-20(9-10-24(22)36-18-25(31)32)15-23(30-26(33)21-11-13-35-17-21)27(34)29-12-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,9-11,13-14,17,23H,4-5,8,12,15,18H2,(H,29,34)(H,30,33)(H,31,32)/t23-/m0/s1 |
| InChIKey | CPMZUHCARLGGHL-QHCPKHFHSA-N |
| XLogP | 3.09 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|