C19H26Cl2N4O2 — CID 119429792
N-[1-[3-(methylamino)propylamino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide;dihydrochloride (PubChem CID 119429792) has the molecular formula C19H26Cl2N4O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is N-[1-[3-(methylamino)propylamino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[1-[3-(methylamino)propylamino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119429792 |
| Molecular Formula | C19H26Cl2N4O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[1-[3-(methylamino)propylamino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide;dihydrochloride |
| SMILES | CNCCCNC(=O)C(Cc1ccccc1)NC(=O)c1cccnc1.Cl.Cl |
| InChI | InChI=1S/C19H24N4O2.2ClH/c1-20-10-6-12-22-19(25)17(13-15-7-3-2-4-8-15)23-18(24)16-9-5-11-21-14-16;;/h2-5,7-9,11,14,17,20H,6,10,12-13H2,1H3,(H,22,25)(H,23,24);2*1H |
| InChIKey | NUJIYOIJJADASX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|