C20H23N3O5 — CID 44586529
(2S)-6-(phenylmethoxycarbonylamino)-2-(pyridine-3-carbonylamino)hexanoic acid (PubChem CID 44586529) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2S)-6-(phenylmethoxycarbonylamino)-2-(pyridine-3-carbonylamino)hexanoic acid.
| Compound Name | (2S)-6-(phenylmethoxycarbonylamino)-2-(pyridine-3-carbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 44586529 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2S)-6-(phenylmethoxycarbonylamino)-2-(pyridine-3-carbonylamino)hexanoic acid |
| SMILES | O=C(NCCCC[C@H](NC(=O)c1cccnc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O5/c24-18(16-9-6-11-21-13-16)23-17(19(25)26)10-4-5-12-22-20(27)28-14-15-7-2-1-3-8-15/h1-3,6-9,11,13,17H,4-5,10,12,14H2,(H,22,27)(H,23,24)(H,25,26)/t17-/m0/s1 |
| InChIKey | CMVYRAWWEOBLGF-KRWDZBQOSA-N |
| XLogP | 2.36 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|