C21H20N4O2 — CID 42534610
N-[(2S)-1-oxo-3-phenyl-1-(pyridin-4-ylmethylamino)propan-2-yl]pyridine-3-carboxamide (PubChem CID 42534610) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[(2S)-1-oxo-3-phenyl-1-(pyridin-4-ylmethylamino)propan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-oxo-3-phenyl-1-(pyridin-4-ylmethylamino)propan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42534610 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(2S)-1-oxo-3-phenyl-1-(pyridin-4-ylmethylamino)propan-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NCc1ccncc1)c1cccnc1 |
| InChI | InChI=1S/C21H20N4O2/c26-20(18-7-4-10-23-15-18)25-19(13-16-5-2-1-3-6-16)21(27)24-14-17-8-11-22-12-9-17/h1-12,15,19H,13-14H2,(H,24,27)(H,25,26)/t19-/m0/s1 |
| InChIKey | RTXUXSOHNKOXIC-IBGZPJMESA-N |
| XLogP | 2.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |