C33H32N2O6 — CID 126343835
benzyl [4-[(2S)-3-oxo-3-(2-phenylethylamino)-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate (PubChem CID 126343835) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is benzyl [4-[(2S)-3-oxo-3-(2-phenylethylamino)-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate.
| Compound Name | benzyl [4-[(2S)-3-oxo-3-(2-phenylethylamino)-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate |
|---|---|
| PubChem CID | 126343835 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | benzyl [4-[(2S)-3-oxo-3-(2-phenylethylamino)-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate |
| SMILES | O=C(N[C@@H](Cc1ccc(OC(=O)OCc2ccccc2)cc1)C(=O)NCCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C33H32N2O6/c36-31(34-21-20-25-10-4-1-5-11-25)30(35-32(37)39-23-27-12-6-2-7-13-27)22-26-16-18-29(19-17-26)41-33(38)40-24-28-14-8-3-9-15-28/h1-19,30H,20-24H2,(H,34,36)(H,35,37)/t30-/m0/s1 |
| InChIKey | YMJMROWRKMFRPO-PMERELPUSA-N |
| XLogP | 5.60 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|