C32H29ClN2O6 — CID 126005918
benzyl [4-[(2R)-3-(5-chloro-2-methylanilino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate (PubChem CID 126005918) has the molecular formula C32H29ClN2O6 and a molecular weight of 573.05 g/mol. Its IUPAC name is benzyl [4-[(2R)-3-(5-chloro-2-methylanilino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate.
| Compound Name | benzyl [4-[(2R)-3-(5-chloro-2-methylanilino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate |
|---|---|
| PubChem CID | 126005918 |
| Molecular Formula | C32H29ClN2O6 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | benzyl [4-[(2R)-3-(5-chloro-2-methylanilino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](Cc1ccc(OC(=O)OCc2ccccc2)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H29ClN2O6/c1-22-12-15-26(33)19-28(22)34-30(36)29(35-31(37)39-20-24-8-4-2-5-9-24)18-23-13-16-27(17-14-23)41-32(38)40-21-25-10-6-3-7-11-25/h2-17,19,29H,18,20-21H2,1H3,(H,34,36)(H,35,37)/t29-/m1/s1 |
| InChIKey | QSVPOZHSCLTJLS-GDLZYMKVSA-N |
| XLogP | 6.84 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|