C24H21ClI2N2O4 — CID 126006102
benzyl N-[(2S)-1-(5-chloro-2-methylanilino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 126006102) has the molecular formula C24H21ClI2N2O4 and a molecular weight of 690.70 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(5-chloro-2-methylanilino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(5-chloro-2-methylanilino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126006102 |
| Molecular Formula | C24H21ClI2N2O4 |
| Molecular Weight | 690.70 g/mol |
| Exact Mass | 689.93 |
| IUPAC Name | benzyl N-[(2S)-1-(5-chloro-2-methylanilino)-3-(4-hydroxy-3,5-diiodophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@H](Cc1cc(I)c(O)c(I)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H21ClI2N2O4/c1-14-7-8-17(25)12-20(14)28-23(31)21(11-16-9-18(26)22(30)19(27)10-16)29-24(32)33-13-15-5-3-2-4-6-15/h2-10,12,21,30H,11,13H2,1H3,(H,28,31)(H,29,32)/t21-/m0/s1 |
| InChIKey | DAAYVJRYVYTCDU-NRFANRHFSA-N |
| XLogP | 6.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|