C24H28I2N2O4 — CID 126008618
benzyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 126008618) has the molecular formula C24H28I2N2O4 and a molecular weight of 662.31 g/mol. Its IUPAC name is benzyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126008618 |
| Molecular Formula | C24H28I2N2O4 |
| Molecular Weight | 662.31 g/mol |
| Exact Mass | 662.01 |
| IUPAC Name | benzyl N-[(2S)-3-(4-hydroxy-3,5-diiodophenyl)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)[C@H](Cc1cc(I)c(O)c(I)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H28I2N2O4/c1-15-7-5-6-10-20(15)27-23(30)21(13-17-11-18(25)22(29)19(26)12-17)28-24(31)32-14-16-8-3-2-4-9-16/h2-4,8-9,11-12,15,20-21,29H,5-7,10,13-14H2,1H3,(H,27,30)(H,28,31)/t15-,20+,21+/m1/s1 |
| InChIKey | LNUAJJYXJQUZQK-NQERJWCQSA-N |
| XLogP | 5.13 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|