C25H20BrI2NO6 — CID 126340716
[2-(4-bromophenyl)-2-oxoethyl] (2R)-3-(4-hydroxy-3,5-diiodophenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 126340716) has the molecular formula C25H20BrI2NO6 and a molecular weight of 764.15 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2R)-3-(4-hydroxy-3,5-diiodophenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2R)-3-(4-hydroxy-3,5-diiodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 126340716 |
| Molecular Formula | C25H20BrI2NO6 |
| Molecular Weight | 764.15 g/mol |
| Exact Mass | 762.86 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2R)-3-(4-hydroxy-3,5-diiodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@H](Cc1cc(I)c(O)c(I)c1)C(=O)OCC(=O)c1ccc(Br)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H20BrI2NO6/c26-18-8-6-17(7-9-18)22(30)14-34-24(32)21(12-16-10-19(27)23(31)20(28)11-16)29-25(33)35-13-15-4-2-1-3-5-15/h1-11,21,31H,12-14H2,(H,29,33)/t21-/m1/s1 |
| InChIKey | HKDHHTNCIFMVAP-OAQYLSRUSA-N |
| XLogP | 5.63 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.15 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|