C37H30N2O7 — CID 126010649
benzyl [4-[(2R)-3-(dibenzofuran-3-ylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate (PubChem CID 126010649) has the molecular formula C37H30N2O7 and a molecular weight of 614.65 g/mol. Its IUPAC name is benzyl [4-[(2R)-3-(dibenzofuran-3-ylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate.
| Compound Name | benzyl [4-[(2R)-3-(dibenzofuran-3-ylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate |
|---|---|
| PubChem CID | 126010649 |
| Molecular Formula | C37H30N2O7 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | benzyl [4-[(2R)-3-(dibenzofuran-3-ylamino)-3-oxo-2-(phenylmethoxycarbonylamino)propyl]phenyl] carbonate |
| SMILES | O=C(N[C@H](Cc1ccc(OC(=O)OCc2ccccc2)cc1)C(=O)Nc1ccc2c(c1)oc1ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C37H30N2O7/c40-35(38-28-17-20-31-30-13-7-8-14-33(30)46-34(31)22-28)32(39-36(41)43-23-26-9-3-1-4-10-26)21-25-15-18-29(19-16-25)45-37(42)44-24-27-11-5-2-6-12-27/h1-20,22,32H,21,23-24H2,(H,38,40)(H,39,41)/t32-/m1/s1 |
| InChIKey | WIZIYQXIAQXDPT-JGCGQSQUSA-N |
| XLogP | 7.78 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|