C18H27N3O5 — CID 101154999
[(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl] acetate (PubChem CID 101154999) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is [(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl] acetate.
| Compound Name | [(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl] acetate |
|---|---|
| PubChem CID | 101154999 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(2S)-3-[3-(dimethylamino)propylamino]-3-oxo-2-(phenylmethoxycarbonylamino)propyl] acetate |
| SMILES | CC(=O)OC[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C18H27N3O5/c1-14(22)25-13-16(17(23)19-10-7-11-21(2)3)20-18(24)26-12-15-8-5-4-6-9-15/h4-6,8-9,16H,7,10-13H2,1-3H3,(H,19,23)(H,20,24)/t16-/m0/s1 |
| InChIKey | BVGSHWUDQQTENU-INIZCTEOSA-N |
| XLogP | 0.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|