C33H28F5O7P — CID 59932197
[difluoro-[4-[3-oxo-3-phenylmethoxy-2-phenylmethoxycarbonyl-2-[[4-(trifluoromethyl)phenyl]methyl]propyl]phenyl]methyl]phosphonic acid (PubChem CID 59932197) has the molecular formula C33H28F5O7P and a molecular weight of 662.54 g/mol. Its IUPAC name is [difluoro-[4-[3-oxo-3-phenylmethoxy-2-phenylmethoxycarbonyl-2-[[4-(trifluoromethyl)phenyl]methyl]propyl]phenyl]methyl]phosphonic acid.
| Compound Name | [difluoro-[4-[3-oxo-3-phenylmethoxy-2-phenylmethoxycarbonyl-2-[[4-(trifluoromethyl)phenyl]methyl]propyl]phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 59932197 |
| Molecular Formula | C33H28F5O7P |
| Molecular Weight | 662.54 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | [difluoro-[4-[3-oxo-3-phenylmethoxy-2-phenylmethoxycarbonyl-2-[[4-(trifluoromethyl)phenyl]methyl]propyl]phenyl]methyl]phosphonic acid |
| SMILES | O=C(OCc1ccccc1)C(Cc1ccc(C(F)(F)F)cc1)(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H28F5O7P/c34-32(35,36)27-15-11-23(12-16-27)19-31(29(39)44-21-25-7-3-1-4-8-25,30(40)45-22-26-9-5-2-6-10-26)20-24-13-17-28(18-14-24)33(37,38)46(41,42)43/h1-18H,19-22H2,(H2,41,42,43) |
| InChIKey | PDEKLUGKAPRXAD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|