C18H17F3O3 — CID 170120976
2-hydroxy-2-(phenylmethoxymethyl)-3-[4-(trifluoromethyl)phenyl]propanal (PubChem CID 170120976) has the molecular formula C18H17F3O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-hydroxy-2-(phenylmethoxymethyl)-3-[4-(trifluoromethyl)phenyl]propanal.
| Compound Name | 2-hydroxy-2-(phenylmethoxymethyl)-3-[4-(trifluoromethyl)phenyl]propanal |
|---|---|
| PubChem CID | 170120976 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-hydroxy-2-(phenylmethoxymethyl)-3-[4-(trifluoromethyl)phenyl]propanal |
| SMILES | O=CC(O)(COCc1ccccc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3O3/c19-18(20,21)16-8-6-14(7-9-16)10-17(23,12-22)13-24-11-15-4-2-1-3-5-15/h1-9,12,23H,10-11,13H2 |
| InChIKey | AQYTWOOZWPQEJD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|