C37H40N2O4 — CID 162716390
2-hydroxy-6-oxo-2-(phenylmethoxymethyl)-6-(4-tritylpiperazin-1-yl)hexanal (PubChem CID 162716390) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is 2-hydroxy-6-oxo-2-(phenylmethoxymethyl)-6-(4-tritylpiperazin-1-yl)hexanal.
| Compound Name | 2-hydroxy-6-oxo-2-(phenylmethoxymethyl)-6-(4-tritylpiperazin-1-yl)hexanal |
|---|---|
| PubChem CID | 162716390 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 2-hydroxy-6-oxo-2-(phenylmethoxymethyl)-6-(4-tritylpiperazin-1-yl)hexanal |
| SMILES | O=CC(O)(CCCC(=O)N1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1)COCc1ccccc1 |
| InChI | InChI=1S/C37H40N2O4/c40-29-36(42,30-43-28-31-14-5-1-6-15-31)23-13-22-35(41)38-24-26-39(27-25-38)37(32-16-7-2-8-17-32,33-18-9-3-10-19-33)34-20-11-4-12-21-34/h1-12,14-21,29,42H,13,22-28,30H2 |
| InChIKey | VDHXEVDRBFYWIW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|