C54H60N2O7 — CID 170080937
(2R,3S,4S,5R,6R)-1-[4-(1,1-diphenylethyl)piperazin-1-yl]-5,6-dihydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptan-1-one (PubChem CID 170080937) has the molecular formula C54H60N2O7 and a molecular weight of 849.08 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-1-[4-(1,1-diphenylethyl)piperazin-1-yl]-5,6-dihydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptan-1-one.
| Compound Name | (2R,3S,4S,5R,6R)-1-[4-(1,1-diphenylethyl)piperazin-1-yl]-5,6-dihydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptan-1-one |
|---|---|
| PubChem CID | 170080937 |
| Molecular Formula | C54H60N2O7 |
| Molecular Weight | 849.08 g/mol |
| Exact Mass | 848.44 |
| IUPAC Name | (2R,3S,4S,5R,6R)-1-[4-(1,1-diphenylethyl)piperazin-1-yl]-5,6-dihydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptan-1-one |
| SMILES | C[C@@H](O)[C@](O)(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)N1CCN(C(C)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C54H60N2O7/c1-42(57)54(59,41-60-37-43-21-9-3-10-22-43)51(63-40-46-27-15-6-16-28-46)49(61-38-44-23-11-4-12-24-44)50(62-39-45-25-13-5-14-26-45)52(58)55-33-35-56(36-34-55)53(2,47-29-17-7-18-30-47)48-31-19-8-20-32-48/h3-32,42,49-51,57,59H,33-41H2,1-2H3/t42-,49-,50-,51+,54-/m1/s1 |
| InChIKey | VNLBKRFVXRHETO-MIJOQCCFSA-N |
| XLogP | 8.18 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.08 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |