C41H48N2O7 — CID 163660245
(2R,3S,4S,5S)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptane-1,6-dione (PubChem CID 163660245) has the molecular formula C41H48N2O7 and a molecular weight of 680.84 g/mol. Its IUPAC name is (2R,3S,4S,5S)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptane-1,6-dione.
| Compound Name | (2R,3S,4S,5S)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptane-1,6-dione |
|---|---|
| PubChem CID | 163660245 |
| Molecular Formula | C41H48N2O7 |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.35 |
| IUPAC Name | (2R,3S,4S,5S)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)heptane-1,6-dione |
| SMILES | CC(=O)[C@](O)(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C41H48N2O7/c1-32(44)41(46,31-47-27-33-15-7-3-8-16-33)39(50-30-36-21-13-6-14-22-36)37(48-28-34-17-9-4-10-18-34)38(49-29-35-19-11-5-12-20-35)40(45)43-25-23-42(2)24-26-43/h3-22,37-39,46H,23-31H2,1-2H3/t37-,38-,39+,41-/m1/s1 |
| InChIKey | ITTWUSRPRWNTLQ-ONDTVOJLSA-N |
| XLogP | 5.05 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |