C32H38N2O6 — CID 154989624
(4S,5R)-2-hydroxy-6-(4-methylpiperazin-1-yl)-6-oxo-2,4,5-tris(phenylmethoxy)hexanal (PubChem CID 154989624) has the molecular formula C32H38N2O6 and a molecular weight of 546.66 g/mol. Its IUPAC name is (4S,5R)-2-hydroxy-6-(4-methylpiperazin-1-yl)-6-oxo-2,4,5-tris(phenylmethoxy)hexanal.
| Compound Name | (4S,5R)-2-hydroxy-6-(4-methylpiperazin-1-yl)-6-oxo-2,4,5-tris(phenylmethoxy)hexanal |
|---|---|
| PubChem CID | 154989624 |
| Molecular Formula | C32H38N2O6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (4S,5R)-2-hydroxy-6-(4-methylpiperazin-1-yl)-6-oxo-2,4,5-tris(phenylmethoxy)hexanal |
| SMILES | CN1CCN(C(=O)[C@H](OCc2ccccc2)[C@H](CC(O)(C=O)OCc2ccccc2)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N2O6/c1-33-17-19-34(20-18-33)31(36)30(39-23-27-13-7-3-8-14-27)29(38-22-26-11-5-2-6-12-26)21-32(37,25-35)40-24-28-15-9-4-10-16-28/h2-16,25,29-30,37H,17-24H2,1H3/t29-,30+,32?/m0/s1 |
| InChIKey | FQYXIUKVPYCJKO-CVTMBVITSA-N |
| XLogP | 3.43 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|