C57H56N2O6 — CID 162716380
(2R,3S,4S)-2,3,4,6-tetrakis(phenylmethoxy)-1-(4-tritylpiperazin-1-yl)hexane-1,5-dione (PubChem CID 162716380) has the molecular formula C57H56N2O6 and a molecular weight of 865.08 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4,6-tetrakis(phenylmethoxy)-1-(4-tritylpiperazin-1-yl)hexane-1,5-dione.
| Compound Name | (2R,3S,4S)-2,3,4,6-tetrakis(phenylmethoxy)-1-(4-tritylpiperazin-1-yl)hexane-1,5-dione |
|---|---|
| PubChem CID | 162716380 |
| Molecular Formula | C57H56N2O6 |
| Molecular Weight | 865.08 g/mol |
| Exact Mass | 864.41 |
| IUPAC Name | (2R,3S,4S)-2,3,4,6-tetrakis(phenylmethoxy)-1-(4-tritylpiperazin-1-yl)hexane-1,5-dione |
| SMILES | O=C(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(=O)N1CCN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C57H56N2O6/c60-52(44-62-40-45-22-8-1-9-23-45)53(63-41-46-24-10-2-11-25-46)54(64-42-47-26-12-3-13-27-47)55(65-43-48-28-14-4-15-29-48)56(61)58-36-38-59(39-37-58)57(49-30-16-5-17-31-49,50-32-18-6-19-33-50)51-34-20-7-21-35-51/h1-35,53-55H,36-44H2/t53-,54+,55-/m1/s1 |
| InChIKey | UDZDFXCSQWMLMW-WGTLWKJYSA-N |
| XLogP | 9.66 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.08 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|