C31H37NO7 — CID 139366264
(2R,3S,4R,5R)-3,5-dihydroxy-1-morpholin-4-yl-2,4,6-tris(phenylmethoxy)hexan-1-one (PubChem CID 139366264) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3,5-dihydroxy-1-morpholin-4-yl-2,4,6-tris(phenylmethoxy)hexan-1-one.
| Compound Name | (2R,3S,4R,5R)-3,5-dihydroxy-1-morpholin-4-yl-2,4,6-tris(phenylmethoxy)hexan-1-one |
|---|---|
| PubChem CID | 139366264 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (2R,3S,4R,5R)-3,5-dihydroxy-1-morpholin-4-yl-2,4,6-tris(phenylmethoxy)hexan-1-one |
| SMILES | O=C([C@H](OCc1ccccc1)[C@@H](O)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C31H37NO7/c33-27(23-37-20-24-10-4-1-5-11-24)29(38-21-25-12-6-2-7-13-25)28(34)30(31(35)32-16-18-36-19-17-32)39-22-26-14-8-3-9-15-26/h1-15,27-30,33-34H,16-23H2/t27-,28+,29-,30-/m1/s1 |
| InChIKey | NXFGUVWTHWLHLG-GOGZTAQTSA-N |
| XLogP | 2.95 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |