C36H41NO7 — CID 25135652
(2R,3S,4S,5R)-5-hydroxy-N-(2-hydroxyethyl)-2,3,4,6-tetrakis(phenylmethoxy)hexanamide (PubChem CID 25135652) has the molecular formula C36H41NO7 and a molecular weight of 599.72 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-hydroxy-N-(2-hydroxyethyl)-2,3,4,6-tetrakis(phenylmethoxy)hexanamide.
| Compound Name | (2R,3S,4S,5R)-5-hydroxy-N-(2-hydroxyethyl)-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
|---|---|
| PubChem CID | 25135652 |
| Molecular Formula | C36H41NO7 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | (2R,3S,4S,5R)-5-hydroxy-N-(2-hydroxyethyl)-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
| SMILES | O=C(NCCO)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C36H41NO7/c38-22-21-37-36(40)35(44-26-31-19-11-4-12-20-31)34(43-25-30-17-9-3-10-18-30)33(42-24-29-15-7-2-8-16-29)32(39)27-41-23-28-13-5-1-6-14-28/h1-20,32-35,38-39H,21-27H2,(H,37,40)/t32-,33+,34+,35-/m1/s1 |
| InChIKey | GUEYDWUZRGNGJD-HDBFZYDSSA-N |
| XLogP | 4.43 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |