C32H39NO5 — CID 102492233
(2E,3R,4R,5R)-2-(butylaminomethylidene)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanal (PubChem CID 102492233) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is (2E,3R,4R,5R)-2-(butylaminomethylidene)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanal.
| Compound Name | (2E,3R,4R,5R)-2-(butylaminomethylidene)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanal |
|---|---|
| PubChem CID | 102492233 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | (2E,3R,4R,5R)-2-(butylaminomethylidene)-5-hydroxy-3,4,6-tris(phenylmethoxy)hexanal |
| SMILES | CCCCN/C=C(/C=O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C32H39NO5/c1-2-3-19-33-20-29(21-34)31(37-23-27-15-9-5-10-16-27)32(38-24-28-17-11-6-12-18-28)30(35)25-36-22-26-13-7-4-8-14-26/h4-18,20-21,30-33,35H,2-3,19,22-25H2,1H3/b29-20-/t30-,31-,32-/m1/s1 |
| InChIKey | WMOZEMIKLKWFPI-NEHXMRAISA-N |
| XLogP | 5.21 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|